Related Experiment Video
Updated: Jul 15, 2026
11:27
Synthesis and Characterization of Functionalized Metal-organic Frameworks
Published on: September 5, 2014
[Mo16O53F2]12-: a new polyoxofluoromolybdate anion.
Adam K Stover1, Jesse R Gutnick, Amy Narducci Sarjeant
1Department of Chemistry, Haverford College, Haverford, Pennsylvania 19041, USA.
Inorganic Chemistry
|May 4, 2007
Summary
Researchers synthesized a new polyoxofluoromolybdate cluster, [Mo16O53F2]12-, the largest reported. This discovery expands knowledge of these complex inorganic anions and their formation pathways.
Area of Science:
- Inorganic Chemistry
- Materials Science
- Crystallography
Background:
- Polyoxomolybdates are versatile inorganic clusters with diverse structures and applications.
- Fluorinated polyoxometalates are less explored but offer unique properties.
- Understanding structure-directing roles in cluster formation is crucial for designing new materials.
Purpose of the Study:
- To synthesize and characterize novel polyoxofluoromolybdate compounds.
- To investigate the formation mechanism of large polyoxofluoromolybdate clusters.
- To explore the structure-directing influence of intermediates in cluster synthesis.
Main Methods:
- Hydrothermal synthesis of beta-octamolybdate salts.
- Subsequent synthesis of a novel polyoxofluoromolybdate.
- Single-crystal X-ray diffraction for structural determination.
Main Results:
- Preparation of [C6H13N2]2[C6H14N2][Mo8O26] under mild hydrothermal conditions.
- Synthesis of [C6H13N2]6[Mo16O53F2].4H2O containing the unprecedented [Mo16O53F2]12- anion.
- Identification of gamma-[Mo8O26]4- as a structure-directing intermediate influencing fluoride incorporation.
- Determination of the crystal structures of both compounds.
Conclusions:
- The largest reported polyoxofluoromolybdate cluster, [Mo16O53F2]12-, has been synthesized and structurally characterized.
- The study highlights the role of intermediates in directing the formation of complex inorganic anions.
- This work expands the library of known polyoxofluoromolybdates and provides insights into their synthesis.
Related Concept Videos
02:48Ionic Bonding and Electron Transfer
Ions are atoms or molecules bearing an electrical charge. A cation (a positive ion) forms when a neutral atom loses one or more electrons from its valence shell, and an anion (a negative ion) forms when a neutral atom gains one or more electrons in its valence shell. Compounds composed of ions are called ionic compounds (or salts), and their constituent ions are held together by ionic bonds: electrostatic forces of attraction between oppositely charged cations and anions.
02:42Ionic Crystal Structures
Ionic crystals consist of two or more different kinds of ions that usually have different sizes. The packing of these ions into a crystal structure is more complex than the packing of metal atoms that are the same size.
Most monatomic ions behave as charged spheres, and their attraction for ions of opposite charge is the same in every direction. Consequently, stable structures for ionic compounds result (1) when ions of one charge are surrounded by as many ions as possible of the opposite...
Most monatomic ions behave as charged spheres, and their attraction for ions of opposite charge is the same in every direction. Consequently, stable structures for ionic compounds result (1) when ions of one charge are surrounded by as many ions as possible of the opposite...
02:54Lewis Structures of Molecular Compounds and Polyatomic Ions
To draw Lewis structures for complicated molecules and molecular ions, it is helpful to follow a step-by-step procedure as outlined:
02:42Valence Bond Theory
Coordination compounds and complexes exhibit different colors, geometries, and magnetic behavior, depending on the metal atom/ion and ligands from which they are composed. In an attempt to explain the bonding and structure of coordination complexes, Linus Pauling proposed the valence bond theory, or VBT, using the concepts of hybridization and the overlapping of the atomic orbitals. According to VBT, the central metal atom or ion (Lewis acid) hybridizes to provide empty orbitals of suitable...
03:34Ionic Compounds: Formulas and Nomenclature
An element composed of atoms that readily lose electrons (a metal) can react with an element composed of atoms that readily gain electrons (a nonmetal) to produce ions through complete electron transfer. The compound formed by this transfer is stabilized by the electrostatic attractions (ionic bonds) between the oppositely charged ions.
03:02Colors and Magnetism
Color in Coordination Complexes
When atoms or molecules absorb light at the proper frequency, their electrons are excited to higher-energy orbitals. For many main group atoms and molecules, the absorbed photons are in the ultraviolet range of the electromagnetic spectrum, which cannot be detected by the human eye. For coordination compounds, the energy difference between the d orbitals often allows photons in the visible range to be absorbed and emitted, which is seen as colors by the human eye.
When atoms or molecules absorb light at the proper frequency, their electrons are excited to higher-energy orbitals. For many main group atoms and molecules, the absorbed photons are in the ultraviolet range of the electromagnetic spectrum, which cannot be detected by the human eye. For coordination compounds, the energy difference between the d orbitals often allows photons in the visible range to be absorbed and emitted, which is seen as colors by the human eye.