Controlled self-assembly of filled micelles on nanotubes

We have used coarse-grained molecular dynamics simulations to show that hydrated lipid micelles of preferred sizes and amounts of filling with hydrophobic molecules can be self-assembled on the surfaces of carbon nanotubes. We simulated micelle formation on a hydrated (40,0) carbon nanotube with an open end that was covered with amphiphilic double-headed CH(3)(CH(2))(14)CH(((CH(2)OCH(2)CH(2))(2)(CH(2)COCH(2)))(2)H)(2) or single-headed CH(3)(CH(2))(14)CH(2)((CH(2)OCH(2)CH(2))(2)(CH(2)COCH(2)))(4)H lipids and filled with hexadecane molecules. Once the hexadecane molecules inside the nanotube were pressurized and the lipids on its surface were dragged by the water flowing around it, kinetically stable micelles filled with hexadecane molecules were sequentially formed at the nanotube tip. We investigated the stability of the thus-formed kinetically stable filled micelles and compared them with thermodynamically stable filled micelles that were self-assembled in the solution.