Molecular Cu(II)-O-Cu(II) complexes: still waters run deep
Peter Haack1, Christian Limberg
1Humboldt-Universität zu Berlin, Institut für Chemie, Brook-Taylor-Strasse 2, 12489 Berlin (Germany).
Angewandte Chemie (International Ed. in English)
|March 12, 2014
Summary
The study reviews rare copper(II)-oxo-copper(II) species, crucial for methane oxidation catalysis. These complexes, once overlooked, are now key to understanding biological and synthetic oxidation processes.
Area of Science:
- Inorganic Chemistry
- Catalysis
- Biochemistry
Background:
- Oxygen activation by copper(I) complexes is vital for biological processes and catalysis.
- The formation of copper(II)-oxo-copper(II) species is rare and challenging to synthesize and characterize.
- These species were previously unappreciated due to a lack of apparent biological relevance.
Purpose of the Study:
- To provide an overview of copper(II)-oxo-copper(II) systems.
- To focus on the reactivity and spectroscopic features of these unique complexes.
- To highlight their emerging importance in methane oxidation.
Main Methods:
- Literature review of existing research on copper(II)-oxo-copper(II) species.
- Analysis of spectroscopic data for characterization.
- Discussion of reactivity studies.
Main Results:
- Copper(II)-oxo-copper(II) cores are proposed as active sites in methane monooxygenase and Cu-zeolite catalysts.
- These complexes exhibit unique electronic properties due to the oxo ligand.
- Their reactivity and spectroscopic signatures are key to understanding their function.
Conclusions:
- Copper(II)-oxo-copper(II) species are critical for efficient methane oxidation.
- Their study is essential for developing new oxidation catalysts and understanding biological mechanisms.
- Further research into their synthesis and reactivity is warranted.
More Related Videos
08:12Surface Functionalization of Metal-Organic Frameworks for Improved Moisture Resistance
Published on: September 5, 2018
15.7K
10:52Multiscale Sampling of a Heterogeneous Water/Metal Catalyst Interface using Density Functional Theory and Force-Field Molecular Dynamics
Published on: April 12, 2019
14.1K
Related Concept Videos
03:02Colors and Magnetism
12.1K
Color in Coordination Complexes
When atoms or molecules absorb light at the proper frequency, their electrons are excited to higher-energy orbitals. For many main group atoms and molecules, the absorbed photons are in the ultraviolet range of the electromagnetic spectrum, which cannot be detected by the human eye. For coordination compounds, the energy difference between the d orbitals often allows photons in the visible range to be absorbed and emitted, which is seen as colors by the human...
When atoms or molecules absorb light at the proper frequency, their electrons are excited to higher-energy orbitals. For many main group atoms and molecules, the absorbed photons are in the ultraviolet range of the electromagnetic spectrum, which cannot be detected by the human eye. For coordination compounds, the energy difference between the d orbitals often allows photons in the visible range to be absorbed and emitted, which is seen as colors by the human...
12.1K
02:58Crystal Field Theory - Octahedral Complexes
28.4K
Crystal Field Theory
To explain the observed behavior of transition metal complexes (such as colors), a model involving electrostatic interactions between the electrons from the ligands and the electrons in the unhybridized d orbitals of the central metal atom has been developed. This electrostatic model is crystal field theory (CFT). It helps to understand, interpret, and predict the colors, magnetic behavior, and some structures of coordination compounds of transition metals.
CFT focuses on...
To explain the observed behavior of transition metal complexes (such as colors), a model involving electrostatic interactions between the electrons from the ligands and the electrons in the unhybridized d orbitals of the central metal atom has been developed. This electrostatic model is crystal field theory (CFT). It helps to understand, interpret, and predict the colors, magnetic behavior, and some structures of coordination compounds of transition metals.
CFT focuses on...
28.4K
01:09Complexation Equilibria: Factors Influencing Stability of Complexes
997
In complexation reactions, metal cations are the electron pair acceptors, and the ligands are the electron pair donors. The stability of the metal complexes depends primarily on the complexing ability of the central metal ion and the nature of the ligands. Generally, the complexing ability of the metal ion depends on the size and charge of the ion. As the metal ion size increases, the stability of the metal complexes decreases, provided that the valency of the metal ion and the ligands remain...
997
03:45Formation of Complex Ions
18.8K
A type of Lewis acid-base chemistry involves the formation of a complex ion (or a coordination complex) comprising a central atom, typically a transition metal cation, surrounded by ions or molecules called ligands. These ligands can be neutral molecules like H2O or NH3, or ions such as CN− or OH−. Often, the ligands act as Lewis bases, donating a pair of electrons to the central atom. These types of Lewis acid-base reactions are examples of a broad subdiscipline called coordination...
18.8K
01:23Complexation Equilibria: Overview
1.6K
Complexation reactions take place when dative or coordinate covalent bonds form between metal ions and ligands. The compounds formed in these reactions are called coordination compounds. The number of bonds formed between the metal ion and the ligands is called its coordination number. Generally, most metal ions in an aqueous solution are solvated by water molecules and thus exist as aqua complexes.
The equilibrium constant of the complexation reaction is represented as the formation constant...
The equilibrium constant of the complexation reaction is represented as the formation constant...
1.6K
01:19Complexation Equilibria: The Chelate Effect
1.7K
In complexation reactions, metal atoms or cations interact with ligands to form donor-acceptor adducts called metal complexes. Ligands that bind through one donor site are monodentate, ligands with two donor sites are bidentate, and those with more than two donor sites are polydentate ligands. For example, ethylene diamine is a bidentate ligand that binds through two nitrogen donor atoms, forming a five-membered ring. EDTA is a polydentate ligand that binds through four oxygen and two nitrogen...
1.7K