Related Experiment Video
Updated: Oct 5, 2025
10:51
The Synthesis, Characterization and Reactivity of a Series of Ruthenium N-triphosPh Complexes
Published on: April 10, 2015
12.3K
Bis(1-bora-4-phosphorinane) ring closure at Cp*M (M = Fe, Co) complexes
Joseph A Zurakowski1, Brady J H Austen1, Kasey R Brown1
1Department of Chemistry and Biochemistry, The University of Windsor, 401 Sunset Avenue, Windsor, ON, N9B 3P4, Canada. marcus.drover@uwindsor.ca.
Chemical Communications (Cambridge, England)
|January 28, 2022
Summary
Researchers synthesized novel Bis(1-bora-4-phosphorinane) metal complexes using a Cp*M-protecting strategy. This method offers a new route to saturated phosphorus-boron main-group ring systems.
Area of Science:
- Organometallic Chemistry
- Main-Group Chemistry
- Coordination Chemistry
Background:
- The synthesis of novel heterocyclic compounds containing both phosphorus and boron is challenging.
- Main-group ring systems offer unique electronic and structural properties for various applications.
Purpose of the Study:
- To develop a new synthetic strategy for Bis(1-bora-4-phosphorinane) metal complexes.
- To explore the generation of saturated phosphorus-boron containing main-group ring systems.
Main Methods:
- Utilized a Cp*M-protecting (M = FeIICl, CoI, Cp* = C5Me5-) strategy for synthesis.
- Structurally characterized the synthesized complexes using NMR spectroscopy and single crystal X-ray diffraction.
Main Results:
- Successfully synthesized Bis(1-bora-4-phosphorinane) metal complexes.
- Demonstrated that the synthesis is highly sensitive to the vinylphosphine precursor.
- Confirmed the structures through spectroscopic and crystallographic analyses.
Conclusions:
- The Cp*M-protecting strategy provides a novel method for generating saturated P,B-containing main-group ring systems.
- This work expands the scope of accessible organometallic and main-group heterocyclic compounds.
Related Concept Videos
02:42Valence Bond Theory
9.8K
Coordination compounds and complexes exhibit different colors, geometries, and magnetic behavior, depending on the metal atom/ion and ligands from which they are composed. In an attempt to explain the bonding and structure of coordination complexes, Linus Pauling proposed the valence bond theory, or VBT, using the concepts of hybridization and the overlapping of the atomic orbitals. According to VBT, the central metal atom or ion (Lewis acid) hybridizes to provide empty orbitals of suitable...
9.8K
03:02Colors and Magnetism
12.5K
Color in Coordination Complexes
When atoms or molecules absorb light at the proper frequency, their electrons are excited to higher-energy orbitals. For many main group atoms and molecules, the absorbed photons are in the ultraviolet range of the electromagnetic spectrum, which cannot be detected by the human eye. For coordination compounds, the energy difference between the d orbitals often allows photons in the visible range to be absorbed and emitted, which is seen as colors by the human...
When atoms or molecules absorb light at the proper frequency, their electrons are excited to higher-energy orbitals. For many main group atoms and molecules, the absorbed photons are in the ultraviolet range of the electromagnetic spectrum, which cannot be detected by the human eye. For coordination compounds, the energy difference between the d orbitals often allows photons in the visible range to be absorbed and emitted, which is seen as colors by the human...
12.5K
01:18Frost Circles for Different Conjugated Systems
3.1K
The inscribed polygon method is consistent with Hückel’s 4n + 2 rule and helps to learn whether the given cyclic compound is aromatic or not. The compound is stable and aromatic if every bonding molecular orbital (MO) is completely filled with a pair of electrons. However, if the non-bonding or antibonding orbitals are filled with electrons, the compound is unstable and not aromatic. Consider the Frost circle diagrams for cycloalkenes containing 4 to 8 carbons.
3.1K
02:58Crystal Field Theory - Octahedral Complexes
28.2K
Crystal Field Theory
To explain the observed behavior of transition metal complexes (such as colors), a model involving electrostatic interactions between the electrons from the ligands and the electrons in the unhybridized d orbitals of the central metal atom has been developed. This electrostatic model is crystal field theory (CFT). It helps to understand, interpret, and predict the colors, magnetic behavior, and some structures of coordination compounds of transition metals.
CFT focuses on...
To explain the observed behavior of transition metal complexes (such as colors), a model involving electrostatic interactions between the electrons from the ligands and the electrons in the unhybridized d orbitals of the central metal atom has been developed. This electrostatic model is crystal field theory (CFT). It helps to understand, interpret, and predict the colors, magnetic behavior, and some structures of coordination compounds of transition metals.
CFT focuses on...
28.2K
02:34Structural Isomerism
19.9K
Isomerism in Complexes
Isomers are different chemical species that have the same chemical formula. Structural isomerism of coordination compounds can be divided into two subcategories, the linkage isomers and coordination-sphere isomers.
Linkage isomers occur when the coordination compound contains a ligand that can bind to the transition metal center through two different atoms. For example, the CN− ligand can bind through the carbon atom or through the nitrogen atom. Similarly, SCN− can...
Isomers are different chemical species that have the same chemical formula. Structural isomerism of coordination compounds can be divided into two subcategories, the linkage isomers and coordination-sphere isomers.
Linkage isomers occur when the coordination compound contains a ligand that can bind to the transition metal center through two different atoms. For example, the CN− ligand can bind through the carbon atom or through the nitrogen atom. Similarly, SCN− can...
19.9K
02:51Metal-Ligand Bonds
21.8K
The hemoglobin in the blood, the chlorophyll in green plants, vitamin B-12, and the catalyst used in the manufacture of polyethylene all contain coordination compounds. Ions of the metals, especially the transition metals, are likely to form complexes.
In these complexes, transition metals form coordinate covalent bonds, a kind of Lewis acid-base interaction in which both of the electrons in the bond are contributed by a donor (Lewis base) to an electron acceptor (Lewis acid). The Lewis acid in...
In these complexes, transition metals form coordinate covalent bonds, a kind of Lewis acid-base interaction in which both of the electrons in the bond are contributed by a donor (Lewis base) to an electron acceptor (Lewis acid). The Lewis acid in...
21.8K