Related Experiment Videos
C(4)N(3)OH(7).Zn(H2O)HPO4, a neutral zincophosphate cluster
Iona Macdonald1, William T A Harrison
1Department of Chemistry, University of Aberdeen, Aberdeen AB24 3UE, Scotland.
Inorganic Chemistry
|November 26, 2002
Abstract:
C(4)N(3)OH(7).Zn(H(2)O)HPO(4), built up from 4-rings of ZnO(2)(H(2)O)N and HPO(4) tetrahedra, is the first neutral, molecular, zincophosphate cluster. The unit-cell packing involves numerous O-H...O and N-H...O hydrogen bonds and pi...pi stacking interactions. Crystal data: C(4)N(3)OH(7).Zn(H(2)O)HPO(4), M(r) = 292.49, triclinic, P1 (No. 2), a = 9.2956(5) A, b = 11.2077(6) A, c = 19.8319(12) A, alpha = 80.314(1) degrees, beta = 78.829(1) degrees, gamma = 89.241(1) degrees, V = 1997.7(2) A(3), Z = 4.